| 4-Amino-3-fluorophenol Chemical Properties |
| Melting point | 135-137°C |
| Boiling point | 270.4±25.0 °C(Predicted) |
| density | 1.347±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.23±0.18(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C6H6FNO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2 |
| InChIKey | MNPLTKHJEAFOCA-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(N)C(F)=C1 |
| CAS DataBase Reference | 399-95-1(CAS DataBase Reference) |
| Safety Information |
| Hazard Codes | T,Xi,N |
| Risk Statements | 22-43-45-51/53 |
| Safety Statements | 45-53-61 |
| RIDADR | 3077 |
| Hazard Note | Toxic |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29214990 |
Name: Eric Yuan
Mobile: 86-18427358861
Tel: 86-18427358861
WhatsApp: +86 18427358861
Email: yihekeji@chembuying.com
Add: